About N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide
N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide (PubChem CID 52641955) has the molecular formula C19H15Cl2N3O3S
and a molecular weight of 436.32 g/mol. Its IUPAC name is N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide |
| PubChem CID | 52641955 |
| Molecular Formula | C19H15Cl2N3O3S |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide |
| SMILES | CSc1cc(C(=O)Cn2cnc3c(Cl)cc(Cl)cc3c2=O)ccc1NC(C)=O |
| InChI | InChI=1S/C19H15Cl2N3O3S/c1-10(25)23-15-4-3-11(5-17(15)28-2)16(26)8-24-9-22-18-13(19(24)27)6-12(20)7-14(18)21/h3-7,9H,8H2,1-2H3,(H,23,25) |
| InChIKey | JGVDDFSEKGNZFT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide?
The IUPAC name of N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide (CID 52641955) is N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide.
What is the SMILES notation for N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide?
The canonical SMILES for N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide is CSc1cc(C(=O)Cn2cnc3c(Cl)cc(Cl)cc3c2=O)ccc1NC(C)=O.
What is the InChIKey of N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide?
The InChIKey is JGVDDFSEKGNZFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15Cl2N3O3S/c1-10(25)23-15-4-3-11(5-17(15)28-2)16(26)8-24-9-22-18-13(19(24)27)6-12(20)7-14(18)21/h3-7,9H,8H2,1-2H3,(H,23,25).
What are the key properties of N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide?
N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide has a molecular weight of 436.32 g/mol, XLogP of 4.27, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[2-(6,8-dichloro-4-oxoquinazolin-3-yl)acetyl]-2-methylsulfanylphenyl]acetamide is sourced from PubChem (CID 52641955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).