About 3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane
3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane (PubChem CID 52644110) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is 3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane |
| PubChem CID | 52644110 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane |
| SMILES | CN1CCC2(CC1)CNCCCN2C |
| InChI | InChI=1S/C11H23N3/c1-13-8-4-11(5-9-13)10-12-6-3-7-14(11)2/h12H,3-10H2,1-2H3 |
| InChIKey | IXJLTJOUBXPZHS-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane?
The IUPAC name of 3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane (CID 52644110) is 3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane.
What is the SMILES notation for 3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane?
The canonical SMILES for 3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane is CN1CCC2(CC1)CNCCCN2C.
What is the InChIKey of 3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane?
The InChIKey is IXJLTJOUBXPZHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3/c1-13-8-4-11(5-9-13)10-12-6-3-7-14(11)2/h12H,3-10H2,1-2H3.
What are the key properties of 3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane?
3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane has a molecular weight of 197.33 g/mol, XLogP of 0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-3,7,11-triazaspiro[5.6]dodecane is sourced from PubChem (CID 52644110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).