About 2-(diethylamino)ethyl 3,3-diphenylpropanoate
2-(diethylamino)ethyl 3,3-diphenylpropanoate (PubChem CID 526545) has the molecular formula C21H27NO2
and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3,3-diphenylpropanoate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 3,3-diphenylpropanoate |
| PubChem CID | 526545 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-(diethylamino)ethyl 3,3-diphenylpropanoate |
| SMILES | CCN(CC)CCOC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO2/c1-3-22(4-2)15-16-24-21(23)17-20(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20H,3-4,15-17H2,1-2H3 |
| InChIKey | ASQMSRQTKSSVSW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)ethyl 3,3-diphenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 3,3-diphenylpropanoate?
The IUPAC name of 2-(diethylamino)ethyl 3,3-diphenylpropanoate (CID 526545) is 2-(diethylamino)ethyl 3,3-diphenylpropanoate.
What is the SMILES notation for 2-(diethylamino)ethyl 3,3-diphenylpropanoate?
The canonical SMILES for 2-(diethylamino)ethyl 3,3-diphenylpropanoate is CCN(CC)CCOC(=O)CC(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(diethylamino)ethyl 3,3-diphenylpropanoate?
The InChIKey is ASQMSRQTKSSVSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO2/c1-3-22(4-2)15-16-24-21(23)17-20(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20H,3-4,15-17H2,1-2H3.
What are the key properties of 2-(diethylamino)ethyl 3,3-diphenylpropanoate?
2-(diethylamino)ethyl 3,3-diphenylpropanoate has a molecular weight of 325.45 g/mol, XLogP of 4.09, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 3,3-diphenylpropanoate is sourced from PubChem (CID 526545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).