C4H8S4 — CID 526622
4,6-dimethyl-1,2,3,5-tetrathiane (PubChem CID 526622) has the molecular formula C4H8S4 and a molecular weight of 184.38 g/mol. Its IUPAC name is 4,6-dimethyl-1,2,3,5-tetrathiane.
| Compound Name | 4,6-dimethyl-1,2,3,5-tetrathiane |
|---|---|
| PubChem CID | 526622 |
| Molecular Formula | C4H8S4 |
| Molecular Weight | 184.38 g/mol |
| Exact Mass | 183.95 |
| IUPAC Name | 4,6-dimethyl-1,2,3,5-tetrathiane |
| SMILES | CC1SSSC(C)S1 |
| InChI | InChI=1S/C4H8S4/c1-3-5-4(2)7-8-6-3/h3-4H,1-2H3 |
| InChIKey | LIAYFMNHMJEGEI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|