C12H14N6O2 — CID 52664309
N-(3-nitro-2-pyridinyl)-N'-pyrimidin-2-ylpropane-1,3-diamine (PubChem CID 52664309) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is N-(3-nitro-2-pyridinyl)-N'-pyrimidin-2-ylpropane-1,3-diamine.
| Compound Name | N-(3-nitro-2-pyridinyl)-N'-pyrimidin-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 52664309 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-(3-nitro-2-pyridinyl)-N'-pyrimidin-2-ylpropane-1,3-diamine |
| SMILES | O=[N+]([O-])c1cccnc1NCCCNc1ncccn1 |
| InChI | InChI=1S/C12H14N6O2/c19-18(20)10-4-1-5-13-11(10)14-6-2-7-15-12-16-8-3-9-17-12/h1,3-5,8-9H,2,6-7H2,(H,13,14)(H,15,16,17) |
| InChIKey | PGOFNKANUXWYNA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|