About 1,2-dihydrotetracene
1,2-dihydrotetracene (PubChem CID 526645) has the molecular formula C18H14
and a molecular weight of 230.31 g/mol. Its IUPAC name is 1,2-dihydrotetracene.
Molecular Properties
| Compound Name | 1,2-dihydrotetracene |
| PubChem CID | 526645 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1,2-dihydrotetracene |
| SMILES | C1=Cc2cc3cc4ccccc4cc3cc2CC1 |
| InChI | InChI=1S/C18H14/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-3,5-7,9-12H,4,8H2 |
| InChIKey | QCAQXQLNGLLHGT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihydrotetracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydrotetracene?
The IUPAC name of 1,2-dihydrotetracene (CID 526645) is 1,2-dihydrotetracene.
What is the SMILES notation for 1,2-dihydrotetracene?
The canonical SMILES for 1,2-dihydrotetracene is C1=Cc2cc3cc4ccccc4cc3cc2CC1.
What is the InChIKey of 1,2-dihydrotetracene?
The InChIKey is QCAQXQLNGLLHGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-3,5-7,9-12H,4,8H2.
What are the key properties of 1,2-dihydrotetracene?
1,2-dihydrotetracene has a molecular weight of 230.31 g/mol, XLogP of 4.95, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydrotetracene is sourced from PubChem (CID 526645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).