C26H28FN3O2 — CID 52667538
3-[3-[(3-fluorophenyl)methoxy]phenyl]-1-methyl-1-[(2-pyrrolidin-1-ylphenyl)methyl]urea (PubChem CID 52667538) has the molecular formula C26H28FN3O2 and a molecular weight of 433.53 g/mol. Its IUPAC name is 3-[3-[(3-fluorophenyl)methoxy]phenyl]-1-methyl-1-[(2-pyrrolidin-1-ylphenyl)methyl]urea.
| Compound Name | 3-[3-[(3-fluorophenyl)methoxy]phenyl]-1-methyl-1-[(2-pyrrolidin-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 52667538 |
| Molecular Formula | C26H28FN3O2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 3-[3-[(3-fluorophenyl)methoxy]phenyl]-1-methyl-1-[(2-pyrrolidin-1-ylphenyl)methyl]urea |
| SMILES | CN(Cc1ccccc1N1CCCC1)C(=O)Nc1cccc(OCc2cccc(F)c2)c1 |
| InChI | InChI=1S/C26H28FN3O2/c1-29(18-21-9-2-3-13-25(21)30-14-4-5-15-30)26(31)28-23-11-7-12-24(17-23)32-19-20-8-6-10-22(27)16-20/h2-3,6-13,16-17H,4-5,14-15,18-19H2,1H3,(H,28,31) |
| InChIKey | ODKUZYUBLUJIFE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |