C29H34N4O4 — CID 5267154
1-[3-(diethylamino)propyl]-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]-5-(2-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 5267154) has the molecular formula C29H34N4O4 and a molecular weight of 502.62 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]-5-(2-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 1-[3-(diethylamino)propyl]-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]-5-(2-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5267154 |
| Molecular Formula | C29H34N4O4 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]-5-(2-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)CCCN1C(=O)C(=O)C(=C(O)c2cnn(-c3ccccc3)c2C)C1c1ccccc1OC |
| InChI | InChI=1S/C29H34N4O4/c1-5-31(6-2)17-12-18-32-26(22-15-10-11-16-24(22)37-4)25(28(35)29(32)36)27(34)23-19-30-33(20(23)3)21-13-8-7-9-14-21/h7-11,13-16,19,26,34H,5-6,12,17-18H2,1-4H3 |
| InChIKey | QJZBPPHTDOUMAM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|