C24H30N4O2 — CID 52673758
2-(4-butoxyphenyl)-5-[[4-(3-methylphenyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole (PubChem CID 52673758) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-5-[[4-(3-methylphenyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-butoxyphenyl)-5-[[4-(3-methylphenyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 52673758 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 2-(4-butoxyphenyl)-5-[[4-(3-methylphenyl)piperazin-1-yl]methyl]-1,3,4-oxadiazole |
| SMILES | CCCCOc1ccc(-c2nnc(CN3CCN(c4cccc(C)c4)CC3)o2)cc1 |
| InChI | InChI=1S/C24H30N4O2/c1-3-4-16-29-22-10-8-20(9-11-22)24-26-25-23(30-24)18-27-12-14-28(15-13-27)21-7-5-6-19(2)17-21/h5-11,17H,3-4,12-16,18H2,1-2H3 |
| InChIKey | HQHSHDCIHDZMIB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|