About prop-2-enyl 2-pentoxyacetate
prop-2-enyl 2-pentoxyacetate (PubChem CID 526760) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is prop-2-enyl 2-pentoxyacetate.
Molecular Properties
| Compound Name | prop-2-enyl 2-pentoxyacetate |
| PubChem CID | 526760 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | prop-2-enyl 2-pentoxyacetate |
| SMILES | C=CCOC(=O)COCCCCC |
| InChI | InChI=1S/C10H18O3/c1-3-5-6-8-12-9-10(11)13-7-4-2/h4H,2-3,5-9H2,1H3 |
| InChIKey | RRIFFBJNXMRMKT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-pentoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-pentoxyacetate?
The IUPAC name of prop-2-enyl 2-pentoxyacetate (CID 526760) is prop-2-enyl 2-pentoxyacetate.
What is the SMILES notation for prop-2-enyl 2-pentoxyacetate?
The canonical SMILES for prop-2-enyl 2-pentoxyacetate is C=CCOC(=O)COCCCCC.
What is the InChIKey of prop-2-enyl 2-pentoxyacetate?
The InChIKey is RRIFFBJNXMRMKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-3-5-6-8-12-9-10(11)13-7-4-2/h4H,2-3,5-9H2,1H3.
What are the key properties of prop-2-enyl 2-pentoxyacetate?
prop-2-enyl 2-pentoxyacetate has a molecular weight of 186.25 g/mol, XLogP of 1.92, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-pentoxyacetate is sourced from PubChem (CID 526760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).