About 6-amino-N,N-dimethylpyridine-3-sulfonamide
6-amino-N,N-dimethylpyridine-3-sulfonamide (PubChem CID 5267643) has the molecular formula C7H11N3O2S
and a molecular weight of 201.25 g/mol. Its IUPAC name is 6-amino-N,N-dimethylpyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 6-amino-N,N-dimethylpyridine-3-sulfonamide |
| PubChem CID | 5267643 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 6-amino-N,N-dimethylpyridine-3-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N)nc1 |
| InChI | InChI=1S/C7H11N3O2S/c1-10(2)13(11,12)6-3-4-7(8)9-5-6/h3-5H,1-2H3,(H2,8,9) |
| InChIKey | OLFVKJUZBCQROA-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-N,N-dimethylpyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N,N-dimethylpyridine-3-sulfonamide?
The IUPAC name of 6-amino-N,N-dimethylpyridine-3-sulfonamide (CID 5267643) is 6-amino-N,N-dimethylpyridine-3-sulfonamide.
What is the SMILES notation for 6-amino-N,N-dimethylpyridine-3-sulfonamide?
The canonical SMILES for 6-amino-N,N-dimethylpyridine-3-sulfonamide is CN(C)S(=O)(=O)c1ccc(N)nc1.
What is the InChIKey of 6-amino-N,N-dimethylpyridine-3-sulfonamide?
The InChIKey is OLFVKJUZBCQROA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2S/c1-10(2)13(11,12)6-3-4-7(8)9-5-6/h3-5H,1-2H3,(H2,8,9).
What are the key properties of 6-amino-N,N-dimethylpyridine-3-sulfonamide?
6-amino-N,N-dimethylpyridine-3-sulfonamide has a molecular weight of 201.25 g/mol, XLogP of -0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N,N-dimethylpyridine-3-sulfonamide is sourced from PubChem (CID 5267643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).