About 6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide
6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide (PubChem CID 5267884) has the molecular formula C17H22FN3O2S
and a molecular weight of 351.45 g/mol. Its IUPAC name is 6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide |
| PubChem CID | 5267884 |
| Molecular Formula | C17H22FN3O2S |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(C)N(C(C)C)S(=O)(=O)c1ccc(Nc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C17H22FN3O2S/c1-12(2)21(13(3)4)24(22,23)16-9-10-17(19-11-16)20-15-7-5-14(18)6-8-15/h5-13H,1-4H3,(H,19,20) |
| InChIKey | AJUWOSMSUUEYOR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide?
The IUPAC name of 6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide (CID 5267884) is 6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide.
What is the SMILES notation for 6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide?
The canonical SMILES for 6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide is CC(C)N(C(C)C)S(=O)(=O)c1ccc(Nc2ccc(F)cc2)nc1.
What is the InChIKey of 6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide?
The InChIKey is AJUWOSMSUUEYOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22FN3O2S/c1-12(2)21(13(3)4)24(22,23)16-9-10-17(19-11-16)20-15-7-5-14(18)6-8-15/h5-13H,1-4H3,(H,19,20).
What are the key properties of 6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide?
6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide has a molecular weight of 351.45 g/mol, XLogP of 3.77, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluoroanilino)-N,N-di(propan-2-yl)pyridine-3-sulfonamide is sourced from PubChem (CID 5267884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).