About N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline
N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline (PubChem CID 52679425) has the molecular formula C14H19N5
and a molecular weight of 257.34 g/mol. Its IUPAC name is N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline.
Molecular Properties
| Compound Name | N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline |
| PubChem CID | 52679425 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline |
| SMILES | Cc1ccc(N(C)Cc2nnnn2C2CC2)c(C)c1 |
| InChI | InChI=1S/C14H19N5/c1-10-4-7-13(11(2)8-10)18(3)9-14-15-16-17-19(14)12-5-6-12/h4,7-8,12H,5-6,9H2,1-3H3 |
| InChIKey | ORGZBEHBLRSZKT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline?
The IUPAC name of N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline (CID 52679425) is N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline.
What is the SMILES notation for N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline?
The canonical SMILES for N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline is Cc1ccc(N(C)Cc2nnnn2C2CC2)c(C)c1.
What is the InChIKey of N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline?
The InChIKey is ORGZBEHBLRSZKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5/c1-10-4-7-13(11(2)8-10)18(3)9-14-15-16-17-19(14)12-5-6-12/h4,7-8,12H,5-6,9H2,1-3H3.
What are the key properties of N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline?
N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline has a molecular weight of 257.34 g/mol, XLogP of 2.26, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-cyclopropyltetrazol-5-yl)methyl]-N,2,4-trimethylaniline is sourced from PubChem (CID 52679425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).