About 3,4,5-trimethoxyoxane
3,4,5-trimethoxyoxane (PubChem CID 526845) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is 3,4,5-trimethoxyoxane.
Molecular Properties
| Compound Name | 3,4,5-trimethoxyoxane |
| PubChem CID | 526845 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 3,4,5-trimethoxyoxane |
| SMILES | COC1COCC(OC)C1OC |
| InChI | InChI=1S/C8H16O4/c1-9-6-4-12-5-7(10-2)8(6)11-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | DKQVTQIPWUFZRF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4,5-trimethoxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-trimethoxyoxane?
The IUPAC name of 3,4,5-trimethoxyoxane (CID 526845) is 3,4,5-trimethoxyoxane.
What is the SMILES notation for 3,4,5-trimethoxyoxane?
The canonical SMILES for 3,4,5-trimethoxyoxane is COC1COCC(OC)C1OC.
What is the InChIKey of 3,4,5-trimethoxyoxane?
The InChIKey is DKQVTQIPWUFZRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4/c1-9-6-4-12-5-7(10-2)8(6)11-3/h6-8H,4-5H2,1-3H3.
What are the key properties of 3,4,5-trimethoxyoxane?
3,4,5-trimethoxyoxane has a molecular weight of 176.21 g/mol, XLogP of 0.06, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trimethoxyoxane is sourced from PubChem (CID 526845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).