About (4,5-diacetyloxyoxan-3-yl) acetate
(4,5-diacetyloxyoxan-3-yl) acetate (PubChem CID 526846) has the molecular formula C11H16O7
and a molecular weight of 260.24 g/mol. Its IUPAC name is (4,5-diacetyloxyoxan-3-yl) acetate.
Molecular Properties
| Compound Name | (4,5-diacetyloxyoxan-3-yl) acetate |
| PubChem CID | 526846 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | (4,5-diacetyloxyoxan-3-yl) acetate |
| SMILES | CC(=O)OC1COCC(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C11H16O7/c1-6(12)16-9-4-15-5-10(17-7(2)13)11(9)18-8(3)14/h9-11H,4-5H2,1-3H3 |
| InChIKey | NEMMESQJOZVCAX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze (4,5-diacetyloxyoxan-3-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-diacetyloxyoxan-3-yl) acetate?
The IUPAC name of (4,5-diacetyloxyoxan-3-yl) acetate (CID 526846) is (4,5-diacetyloxyoxan-3-yl) acetate.
What is the SMILES notation for (4,5-diacetyloxyoxan-3-yl) acetate?
The canonical SMILES for (4,5-diacetyloxyoxan-3-yl) acetate is CC(=O)OC1COCC(OC(C)=O)C1OC(C)=O.
What is the InChIKey of (4,5-diacetyloxyoxan-3-yl) acetate?
The InChIKey is NEMMESQJOZVCAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O7/c1-6(12)16-9-4-15-5-10(17-7(2)13)11(9)18-8(3)14/h9-11H,4-5H2,1-3H3.
What are the key properties of (4,5-diacetyloxyoxan-3-yl) acetate?
(4,5-diacetyloxyoxan-3-yl) acetate has a molecular weight of 260.24 g/mol, XLogP of -0.19, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-diacetyloxyoxan-3-yl) acetate is sourced from PubChem (CID 526846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).