About 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide
1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide (PubChem CID 5268682) has the molecular formula C18H25NO3S
and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide |
| PubChem CID | 5268682 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide |
| SMILES | CCc1ccc(NS(=O)(=O)CC23CCC(CC2=O)C3(C)C)cc1 |
| InChI | InChI=1S/C18H25NO3S/c1-4-13-5-7-15(8-6-13)19-23(21,22)12-18-10-9-14(11-16(18)20)17(18,2)3/h5-8,14,19H,4,9-12H2,1-3H3 |
| InChIKey | WMTRLBWGBLZCSP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide?
The IUPAC name of 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide (CID 5268682) is 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide.
What is the SMILES notation for 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide?
The canonical SMILES for 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide is CCc1ccc(NS(=O)(=O)CC23CCC(CC2=O)C3(C)C)cc1.
What is the InChIKey of 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide?
The InChIKey is WMTRLBWGBLZCSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO3S/c1-4-13-5-7-15(8-6-13)19-23(21,22)12-18-10-9-14(11-16(18)20)17(18,2)3/h5-8,14,19H,4,9-12H2,1-3H3.
What are the key properties of 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide?
1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide has a molecular weight of 335.47 g/mol, XLogP of 3.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-N-(4-ethylphenyl)methanesulfonamide is sourced from PubChem (CID 5268682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).