C20H21F3N6O2S — CID 52688067
1-benzylsulfonyl-4-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]piperazine (PubChem CID 52688067) has the molecular formula C20H21F3N6O2S and a molecular weight of 466.49 g/mol. Its IUPAC name is 1-benzylsulfonyl-4-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]piperazine.
| Compound Name | 1-benzylsulfonyl-4-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]piperazine |
|---|---|
| PubChem CID | 52688067 |
| Molecular Formula | C20H21F3N6O2S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 1-benzylsulfonyl-4-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]piperazine |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCN(Cc2nnnn2-c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H21F3N6O2S/c21-20(22,23)17-6-8-18(9-7-17)29-19(24-25-26-29)14-27-10-12-28(13-11-27)32(30,31)15-16-4-2-1-3-5-16/h1-9H,10-15H2 |
| InChIKey | VMJWWXRZDFXELU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |