About [4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate
[4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate (PubChem CID 5268808) has the molecular formula C25H29NO4S
and a molecular weight of 439.58 g/mol. Its IUPAC name is [4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate |
| PubChem CID | 5268808 |
| Molecular Formula | C25H29NO4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | [4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(C(C)C)cc(Nc3ccccc3O)cc2C(C)C)cc1 |
| InChI | InChI=1S/C25H29NO4S/c1-16(2)21-14-19(26-23-8-6-7-9-24(23)27)15-22(17(3)4)25(21)30-31(28,29)20-12-10-18(5)11-13-20/h6-17,26-27H,1-5H3 |
| InChIKey | ZXQCUEBMIYDFEB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate?
The IUPAC name of [4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate (CID 5268808) is [4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate?
The canonical SMILES for [4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)Oc2c(C(C)C)cc(Nc3ccccc3O)cc2C(C)C)cc1.
What is the InChIKey of [4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate?
The InChIKey is ZXQCUEBMIYDFEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29NO4S/c1-16(2)21-14-19(26-23-8-6-7-9-24(23)27)15-22(17(3)4)25(21)30-31(28,29)20-12-10-18(5)11-13-20/h6-17,26-27H,1-5H3.
What are the key properties of [4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate?
[4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate has a molecular weight of 439.58 g/mol, XLogP of 6.46, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-hydroxyanilino)-2,6-di(propan-2-yl)phenyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 5268808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).