C21H17F3N6O3 — CID 52688740
N-(2-oxochromen-6-yl)-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxamide (PubChem CID 52688740) has the molecular formula C21H17F3N6O3 and a molecular weight of 458.40 g/mol. Its IUPAC name is N-(2-oxochromen-6-yl)-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxamide.
| Compound Name | N-(2-oxochromen-6-yl)-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 52688740 |
| Molecular Formula | C21H17F3N6O3 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-(2-oxochromen-6-yl)-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2oc(=O)ccc2c1)C1CCN(c2ccc3nnc(C(F)(F)F)n3n2)CC1 |
| InChI | InChI=1S/C21H17F3N6O3/c22-21(23,24)20-27-26-16-4-5-17(28-30(16)20)29-9-7-12(8-10-29)19(32)25-14-2-3-15-13(11-14)1-6-18(31)33-15/h1-6,11-12H,7-10H2,(H,25,32) |
| InChIKey | RDCSJJIOFDTFGI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 105.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|