C17H18N4O3S2 — CID 52689269
2-(diethylamino)-N-(2-methyl-3-nitrophenyl)thieno[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 52689269) has the molecular formula C17H18N4O3S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2-methyl-3-nitrophenyl)thieno[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | 2-(diethylamino)-N-(2-methyl-3-nitrophenyl)thieno[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 52689269 |
| Molecular Formula | C17H18N4O3S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2-(diethylamino)-N-(2-methyl-3-nitrophenyl)thieno[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | CCN(CC)c1nc2sc(C(=O)Nc3cccc([N+](=O)[O-])c3C)cc2s1 |
| InChI | InChI=1S/C17H18N4O3S2/c1-4-20(5-2)17-19-16-14(26-17)9-13(25-16)15(22)18-11-7-6-8-12(10(11)3)21(23)24/h6-9H,4-5H2,1-3H3,(H,18,22) |
| InChIKey | XZMXMTQMHGGRBY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|