About N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide
N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide (PubChem CID 52692807) has the molecular formula C10H9N5O5
and a molecular weight of 279.21 g/mol. Its IUPAC name is N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide.
Molecular Properties
| Compound Name | N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide |
| PubChem CID | 52692807 |
| Molecular Formula | C10H9N5O5 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide |
| SMILES | Cc1noc(NC(=O)Cn2cc([N+](=O)[O-])ccc2=O)n1 |
| InChI | InChI=1S/C10H9N5O5/c1-6-11-10(20-13-6)12-8(16)5-14-4-7(15(18)19)2-3-9(14)17/h2-4H,5H2,1H3,(H,11,12,13,16) |
| InChIKey | LQWNZPOMTZXDBV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide?
The IUPAC name of N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide (CID 52692807) is N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide.
What is the SMILES notation for N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide?
The canonical SMILES for N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide is Cc1noc(NC(=O)Cn2cc([N+](=O)[O-])ccc2=O)n1.
What is the InChIKey of N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide?
The InChIKey is LQWNZPOMTZXDBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5O5/c1-6-11-10(20-13-6)12-8(16)5-14-4-7(15(18)19)2-3-9(14)17/h2-4H,5H2,1H3,(H,11,12,13,16).
What are the key properties of N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide?
N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide has a molecular weight of 279.21 g/mol, XLogP of 0.09, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide is sourced from PubChem (CID 52692807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).