About 5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile
5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile (PubChem CID 52693375) has the molecular formula C15H15FN2O3S
and a molecular weight of 322.36 g/mol. Its IUPAC name is 5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile.
Molecular Properties
| Compound Name | 5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile |
| PubChem CID | 52693375 |
| Molecular Formula | C15H15FN2O3S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile |
| SMILES | N#CCCCCS(=O)(=O)Cc1coc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H15FN2O3S/c16-13-6-4-12(5-7-13)15-18-14(10-21-15)11-22(19,20)9-3-1-2-8-17/h4-7,10H,1-3,9,11H2 |
| InChIKey | ZQWLYNUQJYRMRN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 83.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile?
The IUPAC name of 5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile (CID 52693375) is 5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile.
What is the SMILES notation for 5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile?
The canonical SMILES for 5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile is N#CCCCCS(=O)(=O)Cc1coc(-c2ccc(F)cc2)n1.
What is the InChIKey of 5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile?
The InChIKey is ZQWLYNUQJYRMRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FN2O3S/c16-13-6-4-12(5-7-13)15-18-14(10-21-15)11-22(19,20)9-3-1-2-8-17/h4-7,10H,1-3,9,11H2.
What are the key properties of 5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile?
5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile has a molecular weight of 322.36 g/mol, XLogP of 3.09, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfonyl]pentanenitrile is sourced from PubChem (CID 52693375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).