About 5-methylthiolan-3-one
5-methylthiolan-3-one (PubChem CID 526949) has the molecular formula C5H8OS
and a molecular weight of 116.19 g/mol. Its IUPAC name is 5-methylthiolan-3-one.
Molecular Properties
| Compound Name | 5-methylthiolan-3-one |
| PubChem CID | 526949 |
| Molecular Formula | C5H8OS |
| Molecular Weight | 116.19 g/mol |
| Exact Mass | 116.03 |
| IUPAC Name | 5-methylthiolan-3-one |
| SMILES | CC1CC(=O)CS1 |
| InChI | InChI=1S/C5H8OS/c1-4-2-5(6)3-7-4/h4H,2-3H2,1H3 |
| InChIKey | GYAWKNURSWKRNU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methylthiolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylthiolan-3-one?
The IUPAC name of 5-methylthiolan-3-one (CID 526949) is 5-methylthiolan-3-one.
What is the SMILES notation for 5-methylthiolan-3-one?
The canonical SMILES for 5-methylthiolan-3-one is CC1CC(=O)CS1.
What is the InChIKey of 5-methylthiolan-3-one?
The InChIKey is GYAWKNURSWKRNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8OS/c1-4-2-5(6)3-7-4/h4H,2-3H2,1H3.
What are the key properties of 5-methylthiolan-3-one?
5-methylthiolan-3-one has a molecular weight of 116.19 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylthiolan-3-one is sourced from PubChem (CID 526949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).