C30H23N5O5S2 — CID 5269634
methyl 4-[1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 5269634) has the molecular formula C30H23N5O5S2 and a molecular weight of 597.68 g/mol. Its IUPAC name is methyl 4-[1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 5269634 |
| Molecular Formula | C30H23N5O5S2 |
| Molecular Weight | 597.68 g/mol |
| Exact Mass | 597.11 |
| IUPAC Name | methyl 4-[1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(=C(O)c3c(C)nc4ccccn34)C(=O)C(=O)N2c2nnc(SCc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C30H23N5O5S2/c1-17-23(34-15-7-6-10-21(34)31-17)25(36)22-24(19-11-13-20(14-12-19)28(39)40-2)35(27(38)26(22)37)29-32-33-30(42-29)41-16-18-8-4-3-5-9-18/h3-15,24,36H,16H2,1-2H3 |
| InChIKey | PCLUVKAYGAQKRZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 126.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.68 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|