C15H12BrF4NO2S — CID 52697144
2-bromo-4-fluoro-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 52697144) has the molecular formula C15H12BrF4NO2S and a molecular weight of 426.23 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 2-bromo-4-fluoro-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 52697144 |
| Molecular Formula | C15H12BrF4NO2S |
| Molecular Weight | 426.23 g/mol |
| Exact Mass | 424.97 |
| IUPAC Name | 2-bromo-4-fluoro-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | CN(Cc1ccccc1C(F)(F)F)S(=O)(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C15H12BrF4NO2S/c1-21(9-10-4-2-3-5-12(10)15(18,19)20)24(22,23)14-7-6-11(17)8-13(14)16/h2-8H,9H2,1H3 |
| InChIKey | OGHJBSUWPDJQDG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |