C28H21ClN4O5S — CID 5270174
1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 5270174) has the molecular formula C28H21ClN4O5S and a molecular weight of 561.02 g/mol. Its IUPAC name is 1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | 1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5270174 |
| Molecular Formula | C28H21ClN4O5S |
| Molecular Weight | 561.02 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | 1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2C(=C(O)c3c(C)nc4ccccn34)C(=O)C(=O)N2c2nc3ccc(Cl)cc3s2)cc1OC |
| InChI | InChI=1S/C28H21ClN4O5S/c1-14-23(32-11-5-4-6-21(32)30-14)25(34)22-24(15-7-10-18(37-2)19(12-15)38-3)33(27(36)26(22)35)28-31-17-9-8-16(29)13-20(17)39-28/h4-13,24,34H,1-3H3 |
| InChIKey | ZFESCUPMNLDJMB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.02 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|