C15H26N2O4Si — CID 5270498
1-[(1R,3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-5-(2-trimethylsilylethyl)pyrimidine-2,4-dione (PubChem CID 5270498) has the molecular formula C15H26N2O4Si and a molecular weight of 326.47 g/mol. Its IUPAC name is 1-[(1R,3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-5-(2-trimethylsilylethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(1R,3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-5-(2-trimethylsilylethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5270498 |
| Molecular Formula | C15H26N2O4Si |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-[(1R,3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-5-(2-trimethylsilylethyl)pyrimidine-2,4-dione |
| SMILES | C[Si](C)(C)CCc1cn([C@@H]2C[C@H](CO)[C@@H](O)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H26N2O4Si/c1-22(2,3)5-4-10-8-17(15(21)16-14(10)20)12-6-11(9-18)13(19)7-12/h8,11-13,18-19H,4-7,9H2,1-3H3,(H,16,20,21)/t11-,12-,13+/m1/s1 |
| InChIKey | WHLCWKVBZFRYCW-UPJWGTAASA-N |
| XLogP | 0.72 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|