2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid

C13H11F2NO3 — CID 5270598

IUPAC2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid
SMILESO=C(O)C1=C(C(=O)Nc2c(F)cccc2F)CCC1
InChIInChI=1S/C13H11F2NO3/c14-9-5-2-6-10(15)11(9)16-12(17)7-3-1-4-8(7)13(18)19/h2,5-6H,1,3-4H2,(H,16,17)(H,18,19)
InChIKeyFGJDJLGZQXEQQV-UHFFFAOYSA-N
MW267.23 g/mol
LogP2.47
Rot. Bonds3

About 2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid

2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid (PubChem CID 5270598) has the molecular formula C13H11F2NO3 and a molecular weight of 267.23 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid.

Molecular Properties

Compound Name2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid
PubChem CID5270598
Molecular FormulaC13H11F2NO3
Molecular Weight267.23 g/mol
Exact Mass267.07
IUPAC Name2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid
SMILESO=C(O)C1=C(C(=O)Nc2c(F)cccc2F)CCC1
InChIInChI=1S/C13H11F2NO3/c14-9-5-2-6-10(15)11(9)16-12(17)7-3-1-4-8(7)13(18)19/h2,5-6H,1,3-4H2,(H,16,17)(H,18,19)
InChIKeyFGJDJLGZQXEQQV-UHFFFAOYSA-N
XLogP2.47
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.23
LogP ≤ 52.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid?
The IUPAC name of 2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid (CID 5270598) is 2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid.
What is the SMILES notation for 2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid?
The canonical SMILES for 2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid is O=C(O)C1=C(C(=O)Nc2c(F)cccc2F)CCC1.
What is the InChIKey of 2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid?
The InChIKey is FGJDJLGZQXEQQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F2NO3/c14-9-5-2-6-10(15)11(9)16-12(17)7-3-1-4-8(7)13(18)19/h2,5-6H,1,3-4H2,(H,16,17)(H,18,19).
What are the key properties of 2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid?
2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid has a molecular weight of 267.23 g/mol, XLogP of 2.47, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid is sourced from PubChem (CID 5270598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).