C12H16N4O3 — CID 5270730
(1R,2R,3S,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-methoxycyclopentane-1,2-diol (PubChem CID 5270730) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is (1R,2R,3S,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-methoxycyclopentane-1,2-diol.
| Compound Name | (1R,2R,3S,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-methoxycyclopentane-1,2-diol |
|---|---|
| PubChem CID | 5270730 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (1R,2R,3S,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-methoxycyclopentane-1,2-diol |
| SMILES | CO[C@@H]1C[C@H](n2ccc3c(N)ncnc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16N4O3/c1-19-8-4-7(9(17)10(8)18)16-3-2-6-11(13)14-5-15-12(6)16/h2-3,5,7-10,17-18H,4H2,1H3,(H2,13,14,15)/t7-,8+,9+,10-/m0/s1 |
| InChIKey | VEBULQFXEJGXEO-JLIMGVALSA-N |
| XLogP | -0.30 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |