About [1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid
[1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid (PubChem CID 5270771) has the molecular formula C10H15N2O6P
and a molecular weight of 290.21 g/mol. Its IUPAC name is [1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid.
Molecular Properties
| Compound Name | [1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid |
| PubChem CID | 5270771 |
| Molecular Formula | C10H15N2O6P |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | [1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid |
| SMILES | Cc1cn(CC2(OCP(=O)(O)O)CC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N2O6P/c1-7-4-12(9(14)11-8(7)13)5-10(2-3-10)18-6-19(15,16)17/h4H,2-3,5-6H2,1H3,(H,11,13,14)(H2,15,16,17) |
| InChIKey | CCADTCDFWSSIAM-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid?
The IUPAC name of [1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid (CID 5270771) is [1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid.
What is the SMILES notation for [1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid?
The canonical SMILES for [1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid is Cc1cn(CC2(OCP(=O)(O)O)CC2)c(=O)[nH]c1=O.
What is the InChIKey of [1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid?
The InChIKey is CCADTCDFWSSIAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N2O6P/c1-7-4-12(9(14)11-8(7)13)5-10(2-3-10)18-6-19(15,16)17/h4H,2-3,5-6H2,1H3,(H,11,13,14)(H2,15,16,17).
What are the key properties of [1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid?
[1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid has a molecular weight of 290.21 g/mol, XLogP of -0.47, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclopropyl]oxymethylphosphonic acid is sourced from PubChem (CID 5270771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).