C23H20N6 — CID 5270789
4-[[4-[4-[(Z)-2-cyanoprop-1-enyl]-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 5270789) has the molecular formula C23H20N6 and a molecular weight of 380.46 g/mol. Its IUPAC name is 4-[[4-[4-[(Z)-2-cyanoprop-1-enyl]-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-[(Z)-2-cyanoprop-1-enyl]-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 5270789 |
| Molecular Formula | C23H20N6 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-[[4-[4-[(Z)-2-cyanoprop-1-enyl]-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | C/C(C#N)=C/c1cc(C)c(Nc2ccnc(Nc3ccc(C#N)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C23H20N6/c1-15(13-24)10-19-11-16(2)22(17(3)12-19)28-21-8-9-26-23(29-21)27-20-6-4-18(14-25)5-7-20/h4-12H,1-3H3,(H2,26,27,28,29)/b15-10- |
| InChIKey | ACBYVLBXWQRIRC-GDNBJRDFSA-N |
| XLogP | 5.38 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|