C14H9F2N3S — CID 5270827
N,5-bis(4-fluorophenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 5270827) has the molecular formula C14H9F2N3S and a molecular weight of 289.31 g/mol. Its IUPAC name is N,5-bis(4-fluorophenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N,5-bis(4-fluorophenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 5270827 |
| Molecular Formula | C14H9F2N3S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | N,5-bis(4-fluorophenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Fc1ccc(Nc2nnc(-c3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C14H9F2N3S/c15-10-3-1-9(2-4-10)13-18-19-14(20-13)17-12-7-5-11(16)6-8-12/h1-8H,(H,17,19) |
| InChIKey | JVXRQUXWEVWAKJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |