About 1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole
1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole (PubChem CID 52709548) has the molecular formula C14H15F3N2OS
and a molecular weight of 316.35 g/mol. Its IUPAC name is 1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole.
Molecular Properties
| Compound Name | 1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole |
| PubChem CID | 52709548 |
| Molecular Formula | C14H15F3N2OS |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole |
| SMILES | CCn1ccnc1SCc1cccc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3N2OS/c1-2-19-7-6-18-13(19)21-9-11-4-3-5-12(8-11)20-10-14(15,16)17/h3-8H,2,9-10H2,1H3 |
| InChIKey | JDZLQFZMMCQPHB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole?
The IUPAC name of 1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole (CID 52709548) is 1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole.
What is the SMILES notation for 1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole?
The canonical SMILES for 1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole is CCn1ccnc1SCc1cccc(OCC(F)(F)F)c1.
What is the InChIKey of 1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole?
The InChIKey is JDZLQFZMMCQPHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N2OS/c1-2-19-7-6-18-13(19)21-9-11-4-3-5-12(8-11)20-10-14(15,16)17/h3-8H,2,9-10H2,1H3.
What are the key properties of 1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole?
1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole has a molecular weight of 316.35 g/mol, XLogP of 4.14, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]imidazole is sourced from PubChem (CID 52709548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).