C13H14ClN3O4 — CID 5271010
6-[(4-chlorophenyl)methyl]-2-(2-hydroxyethoxymethyl)-1,2,4-triazine-3,5-dione (PubChem CID 5271010) has the molecular formula C13H14ClN3O4 and a molecular weight of 311.73 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methyl]-2-(2-hydroxyethoxymethyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[(4-chlorophenyl)methyl]-2-(2-hydroxyethoxymethyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 5271010 |
| Molecular Formula | C13H14ClN3O4 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 6-[(4-chlorophenyl)methyl]-2-(2-hydroxyethoxymethyl)-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]c(=O)n(COCCO)nc1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H14ClN3O4/c14-10-3-1-9(2-4-10)7-11-12(19)15-13(20)17(16-11)8-21-6-5-18/h1-4,18H,5-8H2,(H,15,19,20) |
| InChIKey | CROMQEXQIAASKX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|