C24H26N2O6 — CID 5271086
[2-[[(E,4S)-7-amino-1-ethoxy-1,7-dioxohept-2-en-4-yl]carbamoyl]phenyl]methyl benzoate (PubChem CID 5271086) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is [2-[[(E,4S)-7-amino-1-ethoxy-1,7-dioxohept-2-en-4-yl]carbamoyl]phenyl]methyl benzoate.
| Compound Name | [2-[[(E,4S)-7-amino-1-ethoxy-1,7-dioxohept-2-en-4-yl]carbamoyl]phenyl]methyl benzoate |
|---|---|
| PubChem CID | 5271086 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [2-[[(E,4S)-7-amino-1-ethoxy-1,7-dioxohept-2-en-4-yl]carbamoyl]phenyl]methyl benzoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(N)=O)NC(=O)c1ccccc1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H26N2O6/c1-2-31-22(28)15-13-19(12-14-21(25)27)26-23(29)20-11-7-6-10-18(20)16-32-24(30)17-8-4-3-5-9-17/h3-11,13,15,19H,2,12,14,16H2,1H3,(H2,25,27)(H,26,29)/b15-13+/t19-/m0/s1 |
| InChIKey | USWZKNNLJWVUBV-LLLGYDHXSA-N |
| XLogP | 2.53 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|