C10H9N5O — CID 5271109
(3-amino-5H-[1,2,4]triazino[5,6-b]indol-8-yl)methanol (PubChem CID 5271109) has the molecular formula C10H9N5O and a molecular weight of 215.22 g/mol. Its IUPAC name is (3-amino-5H-[1,2,4]triazino[5,6-b]indol-8-yl)methanol.
| Compound Name | (3-amino-5H-[1,2,4]triazino[5,6-b]indol-8-yl)methanol |
|---|---|
| PubChem CID | 5271109 |
| Molecular Formula | C10H9N5O |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | (3-amino-5H-[1,2,4]triazino[5,6-b]indol-8-yl)methanol |
| SMILES | Nc1nnc2c(n1)[nH]c1ccc(CO)cc12 |
| InChI | InChI=1S/C10H9N5O/c11-10-13-9-8(14-15-10)6-3-5(4-16)1-2-7(6)12-9/h1-3,16H,4H2,(H3,11,12,13,15) |
| InChIKey | WQDXFPFMTLPYBQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |