C19H12O6 — CID 5271147
6,7-dihydroxy-3,12-dioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),4,6,8,15,17,19-heptaene-14,21-dione (PubChem CID 5271147) has the molecular formula C19H12O6 and a molecular weight of 336.30 g/mol. Its IUPAC name is 6,7-dihydroxy-3,12-dioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),4,6,8,15,17,19-heptaene-14,21-dione.
| Compound Name | 6,7-dihydroxy-3,12-dioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),4,6,8,15,17,19-heptaene-14,21-dione |
|---|---|
| PubChem CID | 5271147 |
| Molecular Formula | C19H12O6 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 6,7-dihydroxy-3,12-dioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),4,6,8,15,17,19-heptaene-14,21-dione |
| SMILES | O=C1C2=C(C(=O)c3ccccc31)C1Oc3cc(O)c(O)cc3C1CO2 |
| InChI | InChI=1S/C19H12O6/c20-12-5-10-11-7-24-19-15(18(11)25-14(10)6-13(12)21)16(22)8-3-1-2-4-9(8)17(19)23/h1-6,11,18,20-21H,7H2 |
| InChIKey | AUWKQWPZURTNLP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|