C27H31N5O3 — CID 52711627
(E)-N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide (PubChem CID 52711627) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is (E)-N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 52711627 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (E)-N-[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide |
| SMILES | Cn1cc(/C=C/C(=O)Nc2ccc(CN3CCN(Cc4ccccc4)CC3)cc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C27H31N5O3/c1-29-20-23(26(34)30(2)27(29)35)10-13-25(33)28-24-11-8-22(9-12-24)19-32-16-14-31(15-17-32)18-21-6-4-3-5-7-21/h3-13,20H,14-19H2,1-2H3,(H,28,33)/b13-10+ |
| InChIKey | UBJPCUVNHCYRSZ-JLHYYAGUSA-N |
| XLogP | 2.05 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|