About 3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole
3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole (PubChem CID 5271169) has the molecular formula C19H26INO2
and a molecular weight of 427.33 g/mol. Its IUPAC name is 3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole |
| PubChem CID | 5271169 |
| Molecular Formula | C19H26INO2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole |
| SMILES | CCc1noc(CC)c1CCCCCCOc1cccc(I)c1 |
| InChI | InChI=1S/C19H26INO2/c1-3-18-17(19(4-2)23-21-18)12-7-5-6-8-13-22-16-11-9-10-15(20)14-16/h9-11,14H,3-8,12-13H2,1-2H3 |
| InChIKey | XWGPLNZGQOZNJG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole?
The IUPAC name of 3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole (CID 5271169) is 3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole.
What is the SMILES notation for 3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole?
The canonical SMILES for 3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole is CCc1noc(CC)c1CCCCCCOc1cccc(I)c1.
What is the InChIKey of 3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole?
The InChIKey is XWGPLNZGQOZNJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26INO2/c1-3-18-17(19(4-2)23-21-18)12-7-5-6-8-13-22-16-11-9-10-15(20)14-16/h9-11,14H,3-8,12-13H2,1-2H3.
What are the key properties of 3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole?
3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole has a molecular weight of 427.33 g/mol, XLogP of 5.59, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-4-[6-(3-iodophenoxy)hexyl]-1,2-oxazole is sourced from PubChem (CID 5271169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).