About 3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole
3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole (PubChem CID 5271172) has the molecular formula C19H26FNO2
and a molecular weight of 319.42 g/mol. Its IUPAC name is 3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole |
| PubChem CID | 5271172 |
| Molecular Formula | C19H26FNO2 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole |
| SMILES | CCc1noc(CC)c1CCCCCCOc1ccccc1F |
| InChI | InChI=1S/C19H26FNO2/c1-3-17-15(18(4-2)23-21-17)11-7-5-6-10-14-22-19-13-9-8-12-16(19)20/h8-9,12-13H,3-7,10-11,14H2,1-2H3 |
| InChIKey | JKDYPBWXDMZSJG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole?
The IUPAC name of 3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole (CID 5271172) is 3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole.
What is the SMILES notation for 3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole?
The canonical SMILES for 3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole is CCc1noc(CC)c1CCCCCCOc1ccccc1F.
What is the InChIKey of 3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole?
The InChIKey is JKDYPBWXDMZSJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26FNO2/c1-3-17-15(18(4-2)23-21-17)11-7-5-6-10-14-22-19-13-9-8-12-16(19)20/h8-9,12-13H,3-7,10-11,14H2,1-2H3.
What are the key properties of 3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole?
3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole has a molecular weight of 319.42 g/mol, XLogP of 5.12, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-4-[6-(2-fluorophenoxy)hexyl]-1,2-oxazole is sourced from PubChem (CID 5271172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).