About 5-methyloct-1-ene
5-methyloct-1-ene (PubChem CID 527118) has the molecular formula C9H18
and a molecular weight of 126.24 g/mol. Its IUPAC name is 5-methyloct-1-ene.
Molecular Properties
| Compound Name | 5-methyloct-1-ene |
| PubChem CID | 527118 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | 5-methyloct-1-ene |
| SMILES | C=CCCC(C)CCC |
| InChI | InChI=1S/C9H18/c1-4-6-8-9(3)7-5-2/h4,9H,1,5-8H2,2-3H3 |
| InChIKey | NGXVSPIYGVZKOB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyloct-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyloct-1-ene?
The IUPAC name of 5-methyloct-1-ene (CID 527118) is 5-methyloct-1-ene.
What is the SMILES notation for 5-methyloct-1-ene?
The canonical SMILES for 5-methyloct-1-ene is C=CCCC(C)CCC.
What is the InChIKey of 5-methyloct-1-ene?
The InChIKey is NGXVSPIYGVZKOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18/c1-4-6-8-9(3)7-5-2/h4,9H,1,5-8H2,2-3H3.
What are the key properties of 5-methyloct-1-ene?
5-methyloct-1-ene has a molecular weight of 126.24 g/mol, XLogP of 3.39, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyloct-1-ene is sourced from PubChem (CID 527118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).