About 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide
4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide (PubChem CID 5271196) has the molecular formula C18H25N3O3
and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide.
Molecular Properties
| Compound Name | 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide |
| PubChem CID | 5271196 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide |
| SMILES | Cc1cc(CCCCCCCOc2ccc(C(=O)NN)cc2)on1 |
| InChI | InChI=1S/C18H25N3O3/c1-14-13-17(24-21-14)7-5-3-2-4-6-12-23-16-10-8-15(9-11-16)18(22)20-19/h8-11,13H,2-7,12,19H2,1H3,(H,20,22) |
| InChIKey | TZWWSBSEYWLMKA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide?
The IUPAC name of 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide (CID 5271196) is 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide.
What is the SMILES notation for 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide?
The canonical SMILES for 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide is Cc1cc(CCCCCCCOc2ccc(C(=O)NN)cc2)on1.
What is the InChIKey of 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide?
The InChIKey is TZWWSBSEYWLMKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O3/c1-14-13-17(24-21-14)7-5-3-2-4-6-12-23-16-10-8-15(9-11-16)18(22)20-19/h8-11,13H,2-7,12,19H2,1H3,(H,20,22).
What are the key properties of 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide?
4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide has a molecular weight of 331.42 g/mol, XLogP of 3.16, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]benzohydrazide is sourced from PubChem (CID 5271196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).