C19H21F3N2O3 — CID 5271225
5-[5-[4-(4,5-dihydro-1,3-oxazol-2-yl)-2-(trifluoromethyl)phenoxy]pentyl]-3-methyl-1,2-oxazole (PubChem CID 5271225) has the molecular formula C19H21F3N2O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is 5-[5-[4-(4,5-dihydro-1,3-oxazol-2-yl)-2-(trifluoromethyl)phenoxy]pentyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[5-[4-(4,5-dihydro-1,3-oxazol-2-yl)-2-(trifluoromethyl)phenoxy]pentyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 5271225 |
| Molecular Formula | C19H21F3N2O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 5-[5-[4-(4,5-dihydro-1,3-oxazol-2-yl)-2-(trifluoromethyl)phenoxy]pentyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(CCCCCOc2ccc(C3=NCCO3)cc2C(F)(F)F)on1 |
| InChI | InChI=1S/C19H21F3N2O3/c1-13-11-15(27-24-13)5-3-2-4-9-25-17-7-6-14(18-23-8-10-26-18)12-16(17)19(20,21)22/h6-7,11-12H,2-5,8-10H2,1H3 |
| InChIKey | XGVXZGHVFAPUTG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 56.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|