C11H14O4 — CID 5271317
(2R,3S,4R,5S)-2-(hydroxymethyl)-5-phenyloxolane-3,4-diol (PubChem CID 5271317) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-(hydroxymethyl)-5-phenyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-phenyloxolane-3,4-diol |
|---|---|
| PubChem CID | 5271317 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-phenyloxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](c2ccccc2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H14O4/c12-6-8-9(13)10(14)11(15-8)7-4-2-1-3-5-7/h1-5,8-14H,6H2/t8-,9-,10-,11+/m1/s1 |
| InChIKey | VXLIVGBVFGMEQD-DBIOUOCHSA-N |
| XLogP | -0.16 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |