About 5-fluoro-2-phenoxyphenol
5-fluoro-2-phenoxyphenol (PubChem CID 5271321) has the molecular formula C12H9FO2
and a molecular weight of 204.20 g/mol. Its IUPAC name is 5-fluoro-2-phenoxyphenol.
Molecular Properties
| Compound Name | 5-fluoro-2-phenoxyphenol |
| PubChem CID | 5271321 |
| Molecular Formula | C12H9FO2 |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 5-fluoro-2-phenoxyphenol |
| SMILES | Oc1cc(F)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C12H9FO2/c13-9-6-7-12(11(14)8-9)15-10-4-2-1-3-5-10/h1-8,14H |
| InChIKey | DEMPPYSGPXLMNG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-2-phenoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-phenoxyphenol?
The IUPAC name of 5-fluoro-2-phenoxyphenol (CID 5271321) is 5-fluoro-2-phenoxyphenol.
What is the SMILES notation for 5-fluoro-2-phenoxyphenol?
The canonical SMILES for 5-fluoro-2-phenoxyphenol is Oc1cc(F)ccc1Oc1ccccc1.
What is the InChIKey of 5-fluoro-2-phenoxyphenol?
The InChIKey is DEMPPYSGPXLMNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FO2/c13-9-6-7-12(11(14)8-9)15-10-4-2-1-3-5-10/h1-8,14H.
What are the key properties of 5-fluoro-2-phenoxyphenol?
5-fluoro-2-phenoxyphenol has a molecular weight of 204.20 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-phenoxyphenol is sourced from PubChem (CID 5271321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).