About N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide
N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide (PubChem CID 5271334) has the molecular formula C21H25N5O4S
and a molecular weight of 443.53 g/mol. Its IUPAC name is N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide |
| PubChem CID | 5271334 |
| Molecular Formula | C21H25N5O4S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCOc2ccc(COc3cnc(N)nc3N)cc2)cc1 |
| InChI | InChI=1S/C21H25N5O4S/c1-15-3-9-18(10-4-15)31(27,28)25-11-2-12-29-17-7-5-16(6-8-17)14-30-19-13-24-21(23)26-20(19)22/h3-10,13,25H,2,11-12,14H2,1H3,(H4,22,23,24,26) |
| InChIKey | ZOGFTOXCTNBHOW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide?
The IUPAC name of N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide (CID 5271334) is N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide.
What is the SMILES notation for N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide?
The canonical SMILES for N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide is Cc1ccc(S(=O)(=O)NCCCOc2ccc(COc3cnc(N)nc3N)cc2)cc1.
What is the InChIKey of N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide?
The InChIKey is ZOGFTOXCTNBHOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N5O4S/c1-15-3-9-18(10-4-15)31(27,28)25-11-2-12-29-17-7-5-16(6-8-17)14-30-19-13-24-21(23)26-20(19)22/h3-10,13,25H,2,11-12,14H2,1H3,(H4,22,23,24,26).
What are the key properties of N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide?
N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide has a molecular weight of 443.53 g/mol, XLogP of 2.28, 10 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[4-[(2,4-diaminopyrimidin-5-yl)oxymethyl]phenoxy]propyl]-4-methylbenzenesulfonamide is sourced from PubChem (CID 5271334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).