About 4-chlorodibenzothiophene
4-chlorodibenzothiophene (PubChem CID 527136) has the molecular formula C12H7ClS
and a molecular weight of 218.71 g/mol. Its IUPAC name is 4-chlorodibenzothiophene.
Molecular Properties
| Compound Name | 4-chlorodibenzothiophene |
| PubChem CID | 527136 |
| Molecular Formula | C12H7ClS |
| Molecular Weight | 218.71 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 4-chlorodibenzothiophene |
| SMILES | Clc1cccc2c1sc1ccccc12 |
| InChI | InChI=1S/C12H7ClS/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7H |
| InChIKey | HGRZBGFNEVHNDV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.71 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chlorodibenzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorodibenzothiophene?
The IUPAC name of 4-chlorodibenzothiophene (CID 527136) is 4-chlorodibenzothiophene.
What is the SMILES notation for 4-chlorodibenzothiophene?
The canonical SMILES for 4-chlorodibenzothiophene is Clc1cccc2c1sc1ccccc12.
What is the InChIKey of 4-chlorodibenzothiophene?
The InChIKey is HGRZBGFNEVHNDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClS/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7H.
What are the key properties of 4-chlorodibenzothiophene?
4-chlorodibenzothiophene has a molecular weight of 218.71 g/mol, XLogP of 4.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorodibenzothiophene is sourced from PubChem (CID 527136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).