C22H20N4O4 — CID 5271441
4-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]benzoic acid (PubChem CID 5271441) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 4-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 5271441 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]benzoic acid |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(C#Cc2ccc(C(=O)O)cc2)c1OC |
| InChI | InChI=1S/C22H20N4O4/c1-29-18-11-14(10-17-12-25-22(24)26-20(17)23)9-16(19(18)30-2)8-5-13-3-6-15(7-4-13)21(27)28/h3-4,6-7,9,11-12H,10H2,1-2H3,(H,27,28)(H4,23,24,25,26) |
| InChIKey | KZSFROFZPJXGFV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|