About dipropyl (Z)-but-2-enedioate
dipropyl (Z)-but-2-enedioate (PubChem CID 5271567) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is dipropyl (Z)-but-2-enedioate.
Molecular Properties
| Compound Name | dipropyl (Z)-but-2-enedioate |
| PubChem CID | 5271567 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | dipropyl (Z)-but-2-enedioate |
| SMILES | CCCOC(=O)/C=C\C(=O)OCCC |
| InChI | InChI=1S/C10H16O4/c1-3-7-13-9(11)5-6-10(12)14-8-4-2/h5-6H,3-4,7-8H2,1-2H3/b6-5- |
| InChIKey | DSTWFRCNXMNXTR-WAYWQWQTSA-N |
| XLogP | 1.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dipropyl (Z)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropyl (Z)-but-2-enedioate?
The IUPAC name of dipropyl (Z)-but-2-enedioate (CID 5271567) is dipropyl (Z)-but-2-enedioate.
What is the SMILES notation for dipropyl (Z)-but-2-enedioate?
The canonical SMILES for dipropyl (Z)-but-2-enedioate is CCCOC(=O)/C=C\C(=O)OCCC.
What is the InChIKey of dipropyl (Z)-but-2-enedioate?
The InChIKey is DSTWFRCNXMNXTR-WAYWQWQTSA-N. The full InChI is InChI=1S/C10H16O4/c1-3-7-13-9(11)5-6-10(12)14-8-4-2/h5-6H,3-4,7-8H2,1-2H3/b6-5-.
What are the key properties of dipropyl (Z)-but-2-enedioate?
dipropyl (Z)-but-2-enedioate has a molecular weight of 200.23 g/mol, XLogP of 1.45, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipropyl (Z)-but-2-enedioate is sourced from PubChem (CID 5271567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).