About 1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine
1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine (PubChem CID 5271720) has the molecular formula C17H16N4
and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine |
| PubChem CID | 5271720 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine |
| SMILES | CN(C)Cn1c2ccccc2c2nc3ccccc3nc21 |
| InChI | InChI=1S/C17H16N4/c1-20(2)11-21-15-10-6-3-7-12(15)16-17(21)19-14-9-5-4-8-13(14)18-16/h3-10H,11H2,1-2H3 |
| InChIKey | VPEIDYYVNIOVLR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine?
The IUPAC name of 1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine (CID 5271720) is 1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine.
What is the SMILES notation for 1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine?
The canonical SMILES for 1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine is CN(C)Cn1c2ccccc2c2nc3ccccc3nc21.
What is the InChIKey of 1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine?
The InChIKey is VPEIDYYVNIOVLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4/c1-20(2)11-21-15-10-6-3-7-12(15)16-17(21)19-14-9-5-4-8-13(14)18-16/h3-10H,11H2,1-2H3.
What are the key properties of 1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine?
1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine has a molecular weight of 276.34 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-indolo[3,2-b]quinoxalin-6-yl-N,N-dimethylmethanamine is sourced from PubChem (CID 5271720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).